CAS 117423-43-5 is the registry number for 4-(((tert-Butyldimethylsilyl)oxy)methyl)picolinonitrile, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-2-carbonitrile (CAS 117423-43-5) is a chemical compound with the molecular formula C13H20N2OSi and a molecular weight of 248.40 g/mol. IUPAC name: 4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-2-carbonitrile. InChIKey: VUKLFFMIMLERLM-UHFFFAOYSA-N.
| Molecular formula | C13H20N2OSi |
|---|---|
| Molecular weight | 248.40 g/mol |
| IUPAC name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-2-carbonitrile |
| InChIKey | VUKLFFMIMLERLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC(=NC=C1)C#N |
Computed by PubChem (NCBI)