Products 1174289-22-5
CAS 1174289-22-5 appears in our catalog under these names: Bazedoxifene N–oxide, Bazedoxifene N-Oxide, Bazedoxifene-N-Oxide, Bazedoxifene Impurity 3, Bazedoxifene N-Oxide, >95% (HPLC). Offered by: GLPBio, Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 5mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-(4-hydroxyphenyl)-3-methyl-1-[[4-[2-(1-oxidoazepan-1-ium-1-yl)ethoxy]phenyl]methyl]indol-5-ol (CAS 1174289-22-5) is a chemical compound with the molecular formula C30H34N2O4 and a molecular weight of 486.6 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-3-methyl-1-[[4-[2-(1-oxidoazepan-1-ium-1-yl)ethoxy]phenyl]methyl]indol-5-ol. InChIKey: CFBANWAZVCOMGU-UHFFFAOYSA-N.
| Molecular formula | C30H34N2O4 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-3-methyl-1-[[4-[2-(1-oxidoazepan-1-ium-1-yl)ethoxy]phenyl]methyl]indol-5-ol |
| InChIKey | CFBANWAZVCOMGU-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)O)CC3=CC=C(C=C3)OCC[N+]4(CCCCCC4)[O-])C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)