CAS 1174335-83-1 appears in our catalog under these names: Nintedanib Impurity 2 (Intedanib Impurity 2), Intedanib(Nintedanib) Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3E)-1-(2-chloroacetyl)-3-[methoxy(phenyl)methylidene]-2-oxoindole-6-carboxylate (CAS 1174335-83-1) is a chemical compound with the molecular formula C20H16ClNO5 and a molecular weight of 385.8 g/mol. IUPAC name: methyl (3E)-1-(2-chloroacetyl)-3-[methoxy(phenyl)methylidene]-2-oxoindole-6-carboxylate. InChIKey: SGESEGRPYLHYDV-ISLYRVAYSA-N.
| Molecular formula | C20H16ClNO5 |
|---|---|
| Molecular weight | 385.8 g/mol |
| IUPAC name | methyl (3E)-1-(2-chloroacetyl)-3-[methoxy(phenyl)methylidene]-2-oxoindole-6-carboxylate |
| InChIKey | SGESEGRPYLHYDV-ISLYRVAYSA-N |
| SMILES | CO/C(=C/1\C2=C(C=C(C=C2)C(=O)OC)N(C1=O)C(=O)CCl)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)