CAS 1174546-69-0 is the registry number for Liothyronine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetate (CAS 1174546-69-0) is a chemical compound with the molecular formula C15H10I4O4 and a molecular weight of 761.85 g/mol. IUPAC name: methyl 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetate. InChIKey: RAFCZQMCHBUBJE-UHFFFAOYSA-N.
| Molecular formula | C15H10I4O4 |
|---|---|
| Molecular weight | 761.85 g/mol |
| IUPAC name | methyl 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]acetate |
| InChIKey | RAFCZQMCHBUBJE-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C(=C1)I)OC2=CC(=C(C(=C2)I)O)I)I |
Computed by PubChem (NCBI)