CAS 117460-98-7 is the registry number for 2-tert-Butyldimethylsilyloxy-1,1-dimethylethylamine. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-amine (CAS 117460-98-7) is a chemical compound with the molecular formula C10H25NOSi and a molecular weight of 203.40 g/mol. IUPAC name: 1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-amine. InChIKey: LXVWNMSXFHNODC-UHFFFAOYSA-N.
| Molecular formula | C10H25NOSi |
|---|---|
| Molecular weight | 203.40 g/mol |
| IUPAC name | 1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-amine |
| InChIKey | LXVWNMSXFHNODC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(C)(C)N |
Computed by PubChem (NCBI)