CAS 117465-54-0 is the registry number for (2S,6R)-2,6-dimethylmorpholin-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,6R)-2,6-dimethylmorpholin-3-one (CAS 117465-54-0) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. IUPAC name: (2S,6R)-2,6-dimethylmorpholin-3-one. InChIKey: CJOJYCRMCKNQNN-UHNVWZDZSA-N.
| Molecular formula | C6H11NO2 |
|---|---|
| Molecular weight | 129.16 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethylmorpholin-3-one |
| InChIKey | CJOJYCRMCKNQNN-UHNVWZDZSA-N |
| SMILES | C[C@@H]1CNC(=O)[C@@H](O1)C |
Computed by PubChem (NCBI)