Products 1174656-25-7
CAS 1174656-25-7 is the registry number for N,N-Diethyl-2-(5-methoxy-1H-indol-3-yl)ethan-1-amine-1,1,2,2-d4. Offered by: TRC. Available pack sizes: 100mg.
1,1,2,2-tetradeuterio-N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine (CAS 1174656-25-7) is a chemical compound with the molecular formula C15H22N2O and a molecular weight of 250.37 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine. InChIKey: KGDVJQQWCDDEPP-LZMSFWOYSA-N.
| Molecular formula | C15H22N2O |
|---|---|
| Molecular weight | 250.37 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine |
| InChIKey | KGDVJQQWCDDEPP-LZMSFWOYSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C=C(C=C2)OC)C([2H])([2H])N(CC)CC |
Computed by PubChem (NCBI)