Products 1174766-05-2
CAS 1174766-05-2 appears in our catalog under these names: 5-(Methoxymethyl)pyridine-3-boronic acid pinacol ester, 95%, 3-(methoxymethyl)-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, ≥95%, ≥95%, 5-(Methoxymethyl)pyridine-3-boronic acid pinacol ester, >=95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g.
3-(methoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1174766-05-2) is a chemical compound with the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. IUPAC name: 3-(methoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: HVUZCEBLLIWKEE-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO3 |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | 3-(methoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | HVUZCEBLLIWKEE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)COC |
Computed by PubChem (NCBI)