CAS 1174905-91-9 is the registry number for ZINC36617540. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methyl-3-[(E)-(N-phenylanilino)diazenyl]quinazolin-4-one (CAS 1174905-91-9) is a chemical compound with the molecular formula C21H17N5O and a molecular weight of 355.4 g/mol. IUPAC name: 2-methyl-3-[(E)-(N-phenylanilino)diazenyl]quinazolin-4-one. InChIKey: TVHWTBCSWIJFSJ-WCWDXBQESA-N.
| Molecular formula | C21H17N5O |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 2-methyl-3-[(E)-(N-phenylanilino)diazenyl]quinazolin-4-one |
| InChIKey | TVHWTBCSWIJFSJ-WCWDXBQESA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=O)N1/N=N/N(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)