CAS 1175-41-3 is the registry number for 4,4′-Methylenebis[1-hydroxy-2-naphthalenecarboxylic acid], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[(3-carboxy-4-hydroxynaphthalen-1-yl)methyl]-1-hydroxynaphthalene-2-carboxylic acid (CAS 1175-41-3) is a chemical compound with the molecular formula C23H16O6 and a molecular weight of 388.4 g/mol. IUPAC name: 4-[(3-carboxy-4-hydroxynaphthalen-1-yl)methyl]-1-hydroxynaphthalene-2-carboxylic acid. InChIKey: XACRYJAWPVFHLE-UHFFFAOYSA-N.
| Molecular formula | C23H16O6 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 4-[(3-carboxy-4-hydroxynaphthalen-1-yl)methyl]-1-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | XACRYJAWPVFHLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2O)C(=O)O)CC3=CC(=C(C4=CC=CC=C43)O)C(=O)O |
Computed by PubChem (NCBI)