Products 1175090-48-8

CAS 1175090-48-8 is the registry number for 4-Fluoro-N-methylaniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

4-fluoro-N-methylaniline;hydrochloride (CAS 1175090-48-8) is a chemical compound with the molecular formula C7H9ClFN and a molecular weight of 161.60 g/mol. IUPAC name: 4-fluoro-N-methylaniline;hydrochloride. InChIKey: NEIBCAKGXOJUMP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClFN
Molecular weight161.60 g/mol
IUPAC name4-fluoro-N-methylaniline;hydrochloride
InChIKeyNEIBCAKGXOJUMP-UHFFFAOYSA-N
SMILESCNC1=CC=C(C=C1)F.Cl

Computed by PubChem (NCBI)