CAS 117522-01-7 is the registry number for Tetramethylammoniumn-butyltriphenylborate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Butyl(triphenyl)boranuide;tetramethylazanium (CAS 117522-01-7) is a chemical compound with the molecular formula C26H36BN and a molecular weight of 373.4 g/mol. IUPAC name: butyl(triphenyl)boranuide;tetramethylazanium. InChIKey: NFVXKTQQPBVJNC-UHFFFAOYSA-N.
| Molecular formula | C26H36BN |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | butyl(triphenyl)boranuide;tetramethylazanium |
| InChIKey | NFVXKTQQPBVJNC-UHFFFAOYSA-N |
| SMILES | [B-](CCCC)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.C[N+](C)(C)C |
Computed by PubChem (NCBI)