CAS 117539-60-3 is the registry number for 1-Bromo-6-trifluoromethyl-naphthalene. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
1-bromo-6-(trifluoromethyl)naphthalene (CAS 117539-60-3) is a chemical compound with the molecular formula C11H6BrF3 and a molecular weight of 275.06 g/mol. IUPAC name: 1-bromo-6-(trifluoromethyl)naphthalene. InChIKey: SASWADBSZGOQTQ-UHFFFAOYSA-N.
| Molecular formula | C11H6BrF3 |
|---|---|
| Molecular weight | 275.06 g/mol |
| IUPAC name | 1-bromo-6-(trifluoromethyl)naphthalene |
| InChIKey | SASWADBSZGOQTQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(F)(F)F)C(=C1)Br |
Computed by PubChem (NCBI)