CAS 1175560-85-6 appears in our catalog under these names: 4-(Cyclopropylmethylsulfonyl)phenylboronic acid, 97%, (4-((Cyclopropylmethyl)sulfonyl)phenyl)boronic acid 97%, 4-(Cyclopropylmethylsulfonyl)phenylboronic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
[4-(cyclopropylmethylsulfonyl)phenyl]boronic acid (CAS 1175560-85-6) is a chemical compound with the molecular formula C10H13BO4S and a molecular weight of 240.09 g/mol. IUPAC name: [4-(cyclopropylmethylsulfonyl)phenyl]boronic acid. InChIKey: DZBUTJPNUVQODY-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4S |
|---|---|
| Molecular weight | 240.09 g/mol |
| IUPAC name | [4-(cyclopropylmethylsulfonyl)phenyl]boronic acid |
| InChIKey | DZBUTJPNUVQODY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)CC2CC2)(O)O |
Computed by PubChem (NCBI)