Products 1175954-87-6
CAS 1175954-87-6 appears in our catalog under these names: Arachidonoyl m–Nitroaniline, Arachidonoyl m-nitroaniline. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, Get quote.
(5Z,8Z,11Z,14Z)-N-(3-nitrophenyl)icosa-5,8,11,14-tetraenamide (CAS 1175954-87-6) is a chemical compound with the molecular formula C26H36N2O3 and a molecular weight of 424.6 g/mol. IUPAC name: (5Z,8Z,11Z,14Z)-N-(3-nitrophenyl)icosa-5,8,11,14-tetraenamide. InChIKey: OITDPRAMDXERDT-DOFZRALJSA-N.
| Molecular formula | C26H36N2O3 |
|---|---|
| Molecular weight | 424.6 g/mol |
| IUPAC name | (5Z,8Z,11Z,14Z)-N-(3-nitrophenyl)icosa-5,8,11,14-tetraenamide |
| InChIKey | OITDPRAMDXERDT-DOFZRALJSA-N |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)