Products 117604-42-9

CAS 117604-42-9 appears in our catalog under these names: Carnitine Chloride Impurity 3, (R)-3-Chloro-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride, 97%, (R)-3-Chloro-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride 96%, 1-Propanaminium,3-chloro-2-hydroxy-N,N,N-trimethyl-, chloride (1:1), (2R)-, 96%, 96%. Offered by: Chemat Brand, AmBeed, Chemat, Fluorochem. Available pack sizes: on request, 25g, 100mg, 250mg, 1g, 5g, 10g, 100g.

Structural formula: {0} (CAS {1})

[(2R)-3-chloro-2-hydroxypropyl]-trimethylazanium chloride (CAS 117604-42-9) is a chemical compound with the molecular formula C6H15Cl2NO and a molecular weight of 188.09 g/mol. IUPAC name: [(2R)-3-chloro-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: CSPHGSFZFWKVDL-RGMNGODLSA-M.

Identity
Molecular formulaC6H15Cl2NO
Molecular weight188.09 g/mol
IUPAC name[(2R)-3-chloro-2-hydroxypropyl]-trimethylazanium chloride
InChIKeyCSPHGSFZFWKVDL-RGMNGODLSA-M
SMILESC[N+](C)(C)C[C@H](CCl)O.[Cl-]

Computed by PubChem (NCBI)