CAS 117632-84-5 appears in our catalog under these names: 1-(Trifluoromethyl)sulphonyl-1h-benzotriazole, 95%, 1-((Trifluoromethyl)sulfonyl)-1H-benzo(d)(1,2,3)triazole, 98%, 1–((Trifluoromethyl)sulfonyl)–1H–benzo(d)(1,2,3)triazole, 1-(Trifluoromethanesulfonyl)-1H-benzotriazole, >98.0%(HPLC), 1-((Trifluoromethyl)sulfonyl)-1H-benzo[d][1,2,3]triazole, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg.
1-(trifluoromethylsulfonyl)benzotriazole (CAS 117632-84-5) is a chemical compound with the molecular formula C7H4F3N3O2S and a molecular weight of 251.19 g/mol. IUPAC name: 1-(trifluoromethylsulfonyl)benzotriazole. InChIKey: QTTZLMGXPHZYKR-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O2S |
|---|---|
| Molecular weight | 251.19 g/mol |
| IUPAC name | 1-(trifluoromethylsulfonyl)benzotriazole |
| InChIKey | QTTZLMGXPHZYKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)