Products 117634-64-7
CAS 117634-64-7 appears in our catalog under these names: Kanshone C, Kanshone C, 99.88%, Kanshone C, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
(1R,3S,6R,7R,8S,10R)-6,7,9,9-tetramethyl-2-oxatetracyclo[5.5.0.01,3.08,10]dodecane-11,12-dione (CAS 117634-64-7) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: (1R,3S,6R,7R,8S,10R)-6,7,9,9-tetramethyl-2-oxatetracyclo[5.5.0.01,3.08,10]dodecane-11,12-dione. InChIKey: NGUGLLPTHUYIGI-CKRUZVNXSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | (1R,3S,6R,7R,8S,10R)-6,7,9,9-tetramethyl-2-oxatetracyclo[5.5.0.01,3.08,10]dodecane-11,12-dione |
| InChIKey | NGUGLLPTHUYIGI-CKRUZVNXSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@@]3([C@]1([C@H]4[C@H](C4(C)C)C(=O)C3=O)C)O2 |
Computed by PubChem (NCBI)
Synonyms:
Kanshone C, orb1942778