CAS 117662-57-4 appears in our catalog under these names: 2,3-Dibromo-1-propan-1,1,2,3,3-d5-ol, 2,3-Dibromo-1-propanol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 10 mg.
2,3-dibromo-1,1,2,3,3-pentadeuteriopropan-1-ol (CAS 117662-57-4) is a chemical compound with the molecular formula C3H6Br2O and a molecular weight of 222.92 g/mol. IUPAC name: 2,3-dibromo-1,1,2,3,3-pentadeuteriopropan-1-ol. InChIKey: QWVCIORZLNBIIC-UXXIZXEISA-N.
| Molecular formula | C3H6Br2O |
|---|---|
| Molecular weight | 222.92 g/mol |
| IUPAC name | 2,3-dibromo-1,1,2,3,3-pentadeuteriopropan-1-ol |
| InChIKey | QWVCIORZLNBIIC-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])Br)Br)O |
Computed by PubChem (NCBI)