CAS 117705-18-7 is the registry number for RP-60503. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] 4-acetamidobutanoate (CAS 117705-18-7) is a chemical compound with the molecular formula C22H19ClN4O4 and a molecular weight of 438.9 g/mol. IUPAC name: [2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] 4-acetamidobutanoate. InChIKey: ARJSFKAHCUBBQS-UHFFFAOYSA-N.
| Molecular formula | C22H19ClN4O4 |
|---|---|
| Molecular weight | 438.9 g/mol |
| IUPAC name | [2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] 4-acetamidobutanoate |
| InChIKey | ARJSFKAHCUBBQS-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCCC(=O)OC1C2=CC=CC=C2C(=O)N1C3=NC4=C(C=C3)C=CC(=N4)Cl |
Computed by PubChem (NCBI)