CAS 1177141-67-1 appears in our catalog under these names: N-(2-Aminoethyl)-5-chloroisoquinoline-8-sulfonamide Dihydrochloride, CKI-7/ 100%, CKI 7 dihydrochloride, CKI 7 dihydrochloride, CKI-7 DIHYDROCHLORIDE. Offered by: TRC, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 50mg, 5mg, 1mg, 10mg, 25mg, 100mg, 200mg, 5 mg.
N-(2-aminoethyl)-5-chloroisoquinoline-8-sulfonamide;dihydrochloride (CAS 1177141-67-1) is a chemical compound with the molecular formula C11H14Cl3N3O2S and a molecular weight of 358.7 g/mol. IUPAC name: N-(2-aminoethyl)-5-chloroisoquinoline-8-sulfonamide;dihydrochloride. InChIKey: JUAVTXYOCISSSL-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3N3O2S |
|---|---|
| Molecular weight | 358.7 g/mol |
| IUPAC name | N-(2-aminoethyl)-5-chloroisoquinoline-8-sulfonamide;dihydrochloride |
| InChIKey | JUAVTXYOCISSSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CN=CC2=C1S(=O)(=O)NCCN)Cl.Cl.Cl |
Computed by PubChem (NCBI)