Products 117719-10-5

CAS 117719-10-5 is the registry number for 2-Amino-5-bromo-3-(ethylamino)pyrazine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

5-bromo-3-N-ethylpyrazine-2,3-diamine (CAS 117719-10-5) is a chemical compound with the molecular formula C6H9BrN4 and a molecular weight of 217.07 g/mol. IUPAC name: 5-bromo-3-N-ethylpyrazine-2,3-diamine. InChIKey: FYOJEGNMDFDYBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BrN4
Molecular weight217.07 g/mol
IUPAC name5-bromo-3-N-ethylpyrazine-2,3-diamine
InChIKeyFYOJEGNMDFDYBZ-UHFFFAOYSA-N
SMILESCCNC1=NC(=CN=C1N)Br

Computed by PubChem (NCBI)