CAS 117727-15-8 appears in our catalog under these names: 2,6-Diazaanthracene-9,10-dione, Pyrido(3,4-G)isoquinoline-5,10-dione. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
Pyrido[3,4-g]isoquinoline-5,10-dione (CAS 117727-15-8) is a chemical compound with the molecular formula C12H6N2O2 and a molecular weight of 210.19 g/mol. IUPAC name: pyrido[3,4-g]isoquinoline-5,10-dione. InChIKey: KFLUOJYWKAUGOT-UHFFFAOYSA-N.
| Molecular formula | C12H6N2O2 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | pyrido[3,4-g]isoquinoline-5,10-dione |
| InChIKey | KFLUOJYWKAUGOT-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=O)C3=C(C2=O)C=CN=C3 |
Computed by PubChem (NCBI)