Products 1177271-46-3

CAS 1177271-46-3 is the registry number for N-(Pyrrolidin-2-ylmethyl)aniline dioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Oxalic acid;N-(pyrrolidin-2-ylmethyl)aniline (CAS 1177271-46-3) is a chemical compound with the molecular formula C15H20N2O8 and a molecular weight of 356.33 g/mol. IUPAC name: oxalic acid;N-(pyrrolidin-2-ylmethyl)aniline. InChIKey: VFIWZAOENWYHER-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20N2O8
Molecular weight356.33 g/mol
IUPAC nameoxalic acid;N-(pyrrolidin-2-ylmethyl)aniline
InChIKeyVFIWZAOENWYHER-UHFFFAOYSA-N
SMILESC1CC(NC1)CNC2=CC=CC=C2.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)