CAS 1177327-68-2 is the registry number for 2-(4-Bromo-2-thienyl)piperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(4-bromothiophen-2-yl)piperidine;hydrochloride (CAS 1177327-68-2) is a chemical compound with the molecular formula C9H13BrClNS and a molecular weight of 282.63 g/mol. IUPAC name: 2-(4-bromothiophen-2-yl)piperidine;hydrochloride. InChIKey: QUNXIIPMDKSEAN-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNS |
|---|---|
| Molecular weight | 282.63 g/mol |
| IUPAC name | 2-(4-bromothiophen-2-yl)piperidine;hydrochloride |
| InChIKey | QUNXIIPMDKSEAN-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC(=CS2)Br.Cl |
Computed by PubChem (NCBI)