CAS 1177339-29-5 appears in our catalog under these names: 2-(5-Fluoro-2-methyl-1h-indol-3-yl)ethanamine oxalate, 95%, 2-(5-Fluoro-2-methyl-1H-indol-3-yl)ethanamine oxalic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 25g, 1g, 10000mg, 5000mg.
2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid (CAS 1177339-29-5) is a chemical compound with the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. IUPAC name: 2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid. InChIKey: VYXRMHXESWCKNV-UHFFFAOYSA-N.
| Molecular formula | C13H15FN2O4 |
|---|---|
| Molecular weight | 282.27 g/mol |
| IUPAC name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
| InChIKey | VYXRMHXESWCKNV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)F)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)