CAS 1177345-85-5 is the registry number for 4-Amino-1-(2-fluorophenyl)pyrrolidin-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-1-(2-fluorophenyl)pyrrolidin-2-one;hydrochloride (CAS 1177345-85-5) is a chemical compound with the molecular formula C10H12ClFN2O and a molecular weight of 230.66 g/mol. IUPAC name: 4-amino-1-(2-fluorophenyl)pyrrolidin-2-one;hydrochloride. InChIKey: JQZOPHRDQIMMBN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFN2O |
|---|---|
| Molecular weight | 230.66 g/mol |
| IUPAC name | 4-amino-1-(2-fluorophenyl)pyrrolidin-2-one;hydrochloride |
| InChIKey | JQZOPHRDQIMMBN-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=CC=C2F)N.Cl |
Computed by PubChem (NCBI)