Products 117756-25-9
CAS 117756-25-9 appears in our catalog under these names: H-Ser-His-OH acetate, 25 mg, H-Ser-His-OH acetate. Offered by: Roth, Biosynth. Available pack sizes: 25mg.
Acetic acid;(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (CAS 117756-25-9) is a chemical compound with the molecular formula C11H18N4O6 and a molecular weight of 302.28 g/mol. IUPAC name: acetic acid;(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: HZEIIESUYNGDHO-LEUCUCNGSA-N.
| Molecular formula | C11H18N4O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | acetic acid;(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | HZEIIESUYNGDHO-LEUCUCNGSA-N |
| SMILES | CC(=O)O.C1=C(NC=N1)C[C@@H](C(=O)O)NC(=O)[C@H](CO)N |
Computed by PubChem (NCBI)
Synonyms:
H-Ser-His-OH acetate, orb1709503