CAS 117756-28-2 is the registry number for PTH-arginine Hydrochloride, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg, 500mg.
2-[3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propyl]guanidine;hydrochloride (CAS 117756-28-2) is a chemical compound with the molecular formula C13H18ClN5OS and a molecular weight of 327.83 g/mol. IUPAC name: 2-[3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propyl]guanidine;hydrochloride. InChIKey: IXKPSQGERWCHMF-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN5OS |
|---|---|
| Molecular weight | 327.83 g/mol |
| IUPAC name | 2-[3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propyl]guanidine;hydrochloride |
| InChIKey | IXKPSQGERWCHMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(NC2=S)CCCN=C(N)N.Cl |
Computed by PubChem (NCBI)