CAS 117757-06-9 is the registry number for Ethyl 1-Thio-beta-D-glucuronide. Offered by: TRC. Available pack sizes: 50mg, 5mg.
(2S,3S,4S,5R,6S)-6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 117757-06-9) is a chemical compound with the molecular formula C8H14O6S and a molecular weight of 238.26 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: XJFLTPWYCFDKGU-XDUWNTRXSA-N.
| Molecular formula | C8H14O6S |
|---|---|
| Molecular weight | 238.26 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | XJFLTPWYCFDKGU-XDUWNTRXSA-N |
| SMILES | CCS[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O)O)O |
Computed by PubChem (NCBI)