CAS 1177618-54-0 appears in our catalog under these names: CGH 2466 dihydrochloride, CGH2466 (dihydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
4-(3,4-dichlorophenyl)-5-pyridin-4-yl-1,3-thiazol-2-amine;dihydrochloride (CAS 1177618-54-0) is a chemical compound with the molecular formula C14H11Cl4N3S and a molecular weight of 395.1 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-5-pyridin-4-yl-1,3-thiazol-2-amine;dihydrochloride. InChIKey: WHXRCTIBFLXKFD-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl4N3S |
|---|---|
| Molecular weight | 395.1 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-5-pyridin-4-yl-1,3-thiazol-2-amine;dihydrochloride |
| InChIKey | WHXRCTIBFLXKFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(SC(=N2)N)C3=CC=NC=C3)Cl)Cl.Cl.Cl |
Computed by PubChem (NCBI)