CAS 1177741-83-1 appears in our catalog under these names: Ski ii, 95%, Sphingosine Kinase Inhibitor 1PC X 10MG. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 10MG.
4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol;hydrochloride (CAS 1177741-83-1) is a chemical compound with the molecular formula C15H12Cl2N2OS and a molecular weight of 339.2 g/mol. IUPAC name: 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol;hydrochloride. InChIKey: ZDRVLAOYDGQLFI-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2N2OS |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol;hydrochloride |
| InChIKey | ZDRVLAOYDGQLFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)NC3=CC=C(C=C3)O)Cl.Cl |
Computed by PubChem (NCBI)