CAS 117796-52-8 appears in our catalog under these names: N-Acetyl Desloratadine, N-Acetyldesloratadine, >95% (HPLC), SCH-37370/ 99.92% (existing batch purity), N–Acetyldesloratadine, N-Acetyldesloratadine. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 1g, 1mg, 5mg, 25mg, 50mg.
1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone (CAS 117796-52-8) is a chemical compound with the molecular formula C21H21ClN2O and a molecular weight of 352.9 g/mol. IUPAC name: 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone. InChIKey: FLTBEMVEAFMWDD-UHFFFAOYSA-N.
| Molecular formula | C21H21ClN2O |
|---|---|
| Molecular weight | 352.9 g/mol |
| IUPAC name | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone |
| InChIKey | FLTBEMVEAFMWDD-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC=C4)C=C(C=C3)Cl)CC1 |
Computed by PubChem (NCBI)