CAS 1178-79-6 is the registry number for Chlorotris(2-methyl-2-phenylpropyl)stannane. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
Chloro-tris(2-methyl-2-phenylpropyl)stannane (CAS 1178-79-6) is a chemical compound with the molecular formula C30H39ClSn and a molecular weight of 553.8 g/mol. IUPAC name: chloro-tris(2-methyl-2-phenylpropyl)stannane. InChIKey: HWTBIXMGMPYDQQ-UHFFFAOYSA-M.
| Molecular formula | C30H39ClSn |
|---|---|
| Molecular weight | 553.8 g/mol |
| IUPAC name | chloro-tris(2-methyl-2-phenylpropyl)stannane |
| InChIKey | HWTBIXMGMPYDQQ-UHFFFAOYSA-M |
| SMILES | CC(C)(C[Sn](CC(C)(C)C1=CC=CC=C1)(CC(C)(C)C2=CC=CC=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)