CAS 1178103-35-9 appears in our catalog under these names: 4-(tert-Butylsulfanyl)-3,5-difluoroaniline, 95%, 4-(tert-Butylsulfanyl)-3,5-difluoroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-tert-butylsulfanyl-3,5-difluoroaniline (CAS 1178103-35-9) is a chemical compound with the molecular formula C10H13F2NS and a molecular weight of 217.28 g/mol. IUPAC name: 4-tert-butylsulfanyl-3,5-difluoroaniline. InChIKey: IPDWULSPLNBCQJ-UHFFFAOYSA-N.
| Molecular formula | C10H13F2NS |
|---|---|
| Molecular weight | 217.28 g/mol |
| IUPAC name | 4-tert-butylsulfanyl-3,5-difluoroaniline |
| InChIKey | IPDWULSPLNBCQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)SC1=C(C=C(C=C1F)N)F |
Computed by PubChem (NCBI)