CAS 1178153-34-8 appears in our catalog under these names: 3-(5-(Difluoromethyl)-1,3,4-oxadiazol-2-yl)propanoic acid, 95%, 3-(5-(Difluoromethyl)-1,3,4-oxadiazol-2-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]propanoic acid (CAS 1178153-34-8) is a chemical compound with the molecular formula C6H6F2N2O3 and a molecular weight of 192.12 g/mol. IUPAC name: 3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]propanoic acid. InChIKey: KOBXYOAENUITRX-UHFFFAOYSA-N.
| Molecular formula | C6H6F2N2O3 |
|---|---|
| Molecular weight | 192.12 g/mol |
| IUPAC name | 3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]propanoic acid |
| InChIKey | KOBXYOAENUITRX-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C1=NN=C(O1)C(F)F |
Computed by PubChem (NCBI)