Products 1178299-94-9

CAS 1178299-94-9 appears in our catalog under these names: 3,5-Dimethyl-1-octyl-1H-pyrazole-4-sulfonyl chloride, 95%, 3,5-Dimethyl-1-octyl-1H-pyrazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

3,5-dimethyl-1-octylpyrazole-4-sulfonyl chloride (CAS 1178299-94-9) is a chemical compound with the molecular formula C13H23ClN2O2S and a molecular weight of 306.85 g/mol. IUPAC name: 3,5-dimethyl-1-octylpyrazole-4-sulfonyl chloride. InChIKey: GPBFNXPDDCACBU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H23ClN2O2S
Molecular weight306.85 g/mol
IUPAC name3,5-dimethyl-1-octylpyrazole-4-sulfonyl chloride
InChIKeyGPBFNXPDDCACBU-UHFFFAOYSA-N
SMILESCCCCCCCCN1C(=C(C(=N1)C)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)