Products 1178583-17-9

CAS 1178583-17-9 is the registry number for PERK/eIF2α activator 1, 98.88%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 25 mg, 100 mg, 5 mg.

Structural formula: {0} (CAS {1})

7-[4-[bis(2-hydroxyethyl)amino]butoxy]-5-hydroxy-8-methoxy-2-phenylchromen-4-one (CAS 1178583-17-9) is a chemical compound with the molecular formula C24H29NO7 and a molecular weight of 443.5 g/mol. IUPAC name: 7-[4-[bis(2-hydroxyethyl)amino]butoxy]-5-hydroxy-8-methoxy-2-phenylchromen-4-one. InChIKey: QWQDULIQJQIEKB-UHFFFAOYSA-N.

Identity
Molecular formulaC24H29NO7
Molecular weight443.5 g/mol
IUPAC name7-[4-[bis(2-hydroxyethyl)amino]butoxy]-5-hydroxy-8-methoxy-2-phenylchromen-4-one
InChIKeyQWQDULIQJQIEKB-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=CC=C3)O)OCCCCN(CCO)CCO

Computed by PubChem (NCBI)