CAS 1178727-53-1 appears in our catalog under these names: 2-Amino-2-(5-bromo-2-methoxyphenyl)ethan-1-ol, 95%, 2-Amino-2-(5-bromo-2-methoxyphenyl)ethan-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-amino-2-(5-bromo-2-methoxyphenyl)ethanol (CAS 1178727-53-1) is a chemical compound with the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. IUPAC name: 2-amino-2-(5-bromo-2-methoxyphenyl)ethanol. InChIKey: JIIQSZURHGJXTF-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2 |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 2-amino-2-(5-bromo-2-methoxyphenyl)ethanol |
| InChIKey | JIIQSZURHGJXTF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C(CO)N |
Computed by PubChem (NCBI)