Products 1178783-48-6
CAS 1178783-48-6 is the registry number for 5-Bromo-N-(1-(1,5-dimethyl-1H-pyrazol-4-yl)ethyl)thiophene-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]thiophene-3-carboxamide (CAS 1178783-48-6) is a chemical compound with the molecular formula C12H14BrN3OS and a molecular weight of 328.23 g/mol. IUPAC name: 5-bromo-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]thiophene-3-carboxamide. InChIKey: ZQVOFOOIMLCSNP-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3OS |
|---|---|
| Molecular weight | 328.23 g/mol |
| IUPAC name | 5-bromo-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]thiophene-3-carboxamide |
| InChIKey | ZQVOFOOIMLCSNP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C(C)NC(=O)C2=CSC(=C2)Br |
Computed by PubChem (NCBI)