CAS 1178884-33-7 is the registry number for 6-(Dimethylamino)-1,2,3,4-tetrahydroisoquinolin-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-(dimethylamino)-3,4-dihydro-2H-isoquinolin-1-one (CAS 1178884-33-7) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 6-(dimethylamino)-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: YMVYDDCPVLLCNR-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 6-(dimethylamino)-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | YMVYDDCPVLLCNR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=O)NCC2 |
Computed by PubChem (NCBI)