CAS 1178899-92-7 appears in our catalog under these names: N3-D-Lys(Boc)-OH, Na-N3-Ne-Boc-D-lysine, 99%. Offered by: Iris Biotech, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 25g, 500mg, Get quote.
(2R)-2-azido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1178899-92-7) is a chemical compound with the molecular formula C11H20N4O4 and a molecular weight of 272.30 g/mol. IUPAC name: (2R)-2-azido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: KROYNWSGVIHIMN-MRVPVSSYSA-N.
| Molecular formula | C11H20N4O4 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | (2R)-2-azido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | KROYNWSGVIHIMN-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)