CAS 1179023-60-9 appears in our catalog under these names: 2-(2,4-Dichloro-5-fluorophenyl)morpholine, 98%, 2-(2,4-Dichloro-5-fluorophenyl)morpholine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
2-(2,4-dichloro-5-fluorophenyl)morpholine (CAS 1179023-60-9) is a chemical compound with the molecular formula C10H10Cl2FNO and a molecular weight of 250.09 g/mol. IUPAC name: 2-(2,4-dichloro-5-fluorophenyl)morpholine. InChIKey: FLADAOLOZKSSFB-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2FNO |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | 2-(2,4-dichloro-5-fluorophenyl)morpholine |
| InChIKey | FLADAOLOZKSSFB-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC(=C(C=C2Cl)Cl)F |
Computed by PubChem (NCBI)