CAS 1179075-22-9 appears in our catalog under these names: 3-Chloro-2-((2,2-difluoroethyl)sulfanyl)aniline, 95%, 3-Chloro-2-((2,2-difluoroethyl)sulfanyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-chloro-2-(2,2-difluoroethylsulfanyl)aniline (CAS 1179075-22-9) is a chemical compound with the molecular formula C8H8ClF2NS and a molecular weight of 223.67 g/mol. IUPAC name: 3-chloro-2-(2,2-difluoroethylsulfanyl)aniline. InChIKey: BNCQGWMLWMLWEN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NS |
|---|---|
| Molecular weight | 223.67 g/mol |
| IUPAC name | 3-chloro-2-(2,2-difluoroethylsulfanyl)aniline |
| InChIKey | BNCQGWMLWMLWEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)SCC(F)F)N |
Computed by PubChem (NCBI)