CAS 1179187-52-0 is the registry number for 1,1-Bis(3-fluorophenyl)-N-methylmethanamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1,1-bis(3-fluorophenyl)-N-methylmethanamine (CAS 1179187-52-0) is a chemical compound with the molecular formula C14H13F2N and a molecular weight of 233.26 g/mol. IUPAC name: 1,1-bis(3-fluorophenyl)-N-methylmethanamine. InChIKey: VGCRVTHPEBLNBY-UHFFFAOYSA-N.
| Molecular formula | C14H13F2N |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 1,1-bis(3-fluorophenyl)-N-methylmethanamine |
| InChIKey | VGCRVTHPEBLNBY-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC(=CC=C1)F)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)