CAS 1179310-74-7 is the registry number for 3-(2,6-dimethylmorpholino)-5-fluoroaniline. Offered by: TRC. Available pack sizes: 2,5g.
3-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline (CAS 1179310-74-7) is a chemical compound with the molecular formula C12H17FN2O and a molecular weight of 224.27 g/mol. IUPAC name: 3-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline. InChIKey: YCTPWEHIPGJMBJ-UHFFFAOYSA-N.
| Molecular formula | C12H17FN2O |
|---|---|
| Molecular weight | 224.27 g/mol |
| IUPAC name | 3-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline |
| InChIKey | YCTPWEHIPGJMBJ-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=CC(=CC(=C2)N)F |
Computed by PubChem (NCBI)