CAS 117932-70-4 is the registry number for 3-(tert-Butyl-dimethyl-silanyloxy)-2,2-dimethyl-propan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropan-1-ol (CAS 117932-70-4) is a chemical compound with the molecular formula C11H26O2Si and a molecular weight of 218.41 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropan-1-ol. InChIKey: GBLPMGGDCFBKAT-UHFFFAOYSA-N.
| Molecular formula | C11H26O2Si |
|---|---|
| Molecular weight | 218.41 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropan-1-ol |
| InChIKey | GBLPMGGDCFBKAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(C)(C)CO |
Computed by PubChem (NCBI)