Products 1179359-59-1
CAS 1179359-59-1 is the registry number for 4-Ethylpicolinimidamide hydrochloride, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[amino-(4-ethyl-2-pyridinyl)methylidene]azanium chloride (CAS 1179359-59-1) is a chemical compound with the molecular formula C8H12ClN3 and a molecular weight of 185.65 g/mol. IUPAC name: [amino-(4-ethyl-2-pyridinyl)methylidene]azanium chloride. InChIKey: BMJHOISOXVREQJ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3 |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | [amino-(4-ethyl-2-pyridinyl)methylidene]azanium chloride |
| InChIKey | BMJHOISOXVREQJ-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=NC=C1)C(=[NH2+])N.[Cl-] |
Computed by PubChem (NCBI)