CAS 1179360-60-1 is the registry number for 3-Bromopicolinimidamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromopyridine-2-carboximidamide;hydrochloride (CAS 1179360-60-1) is a chemical compound with the molecular formula C6H7BrClN3 and a molecular weight of 236.50 g/mol. IUPAC name: 3-bromopyridine-2-carboximidamide;hydrochloride. InChIKey: NOLDHUMYCPCWAQ-UHFFFAOYSA-N.
| Molecular formula | C6H7BrClN3 |
|---|---|
| Molecular weight | 236.50 g/mol |
| IUPAC name | 3-bromopyridine-2-carboximidamide;hydrochloride |
| InChIKey | NOLDHUMYCPCWAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=N)N)Br.Cl |
Computed by PubChem (NCBI)