Products 1179364-81-8

CAS 1179364-81-8 is the registry number for N,N-Dimethyl-3-(piperazin-1-yl)propanamide dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

N,N-dimethyl-3-piperazin-1-ylpropanamide;dihydrochloride (CAS 1179364-81-8) is a chemical compound with the molecular formula C9H21Cl2N3O and a molecular weight of 258.19 g/mol. IUPAC name: N,N-dimethyl-3-piperazin-1-ylpropanamide;dihydrochloride. InChIKey: VDLCRZYXWIEQJI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H21Cl2N3O
Molecular weight258.19 g/mol
IUPAC nameN,N-dimethyl-3-piperazin-1-ylpropanamide;dihydrochloride
InChIKeyVDLCRZYXWIEQJI-UHFFFAOYSA-N
SMILESCN(C)C(=O)CCN1CCNCC1.Cl.Cl

Computed by PubChem (NCBI)